C15H15BrN2O2 — CID 95620420
N-[(3R)-1-(2-bromophenyl)pyrrolidin-3-yl]furan-3-carboxamide (PubChem CID 95620420) has the molecular formula C15H15BrN2O2 and a molecular weight of 335.20 g/mol. Its IUPAC name is N-[(3R)-1-(2-bromophenyl)pyrrolidin-3-yl]furan-3-carboxamide.
| Compound Name | N-[(3R)-1-(2-bromophenyl)pyrrolidin-3-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 95620420 |
| Molecular Formula | C15H15BrN2O2 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | N-[(3R)-1-(2-bromophenyl)pyrrolidin-3-yl]furan-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCN(c2ccccc2Br)C1)c1ccoc1 |
| InChI | InChI=1S/C15H15BrN2O2/c16-13-3-1-2-4-14(13)18-7-5-12(9-18)17-15(19)11-6-8-20-10-11/h1-4,6,8,10,12H,5,7,9H2,(H,17,19)/t12-/m1/s1 |
| InChIKey | JZEWYORBSRSIJM-GFCCVEGCSA-N |
| XLogP | 3.05 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |