C14H15N3O2 — CID 99697234
N-[(3R)-1-pyridin-2-ylpyrrolidin-3-yl]furan-3-carboxamide (PubChem CID 99697234) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is N-[(3R)-1-pyridin-2-ylpyrrolidin-3-yl]furan-3-carboxamide.
| Compound Name | N-[(3R)-1-pyridin-2-ylpyrrolidin-3-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 99697234 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[(3R)-1-pyridin-2-ylpyrrolidin-3-yl]furan-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCN(c2ccccn2)C1)c1ccoc1 |
| InChI | InChI=1S/C14H15N3O2/c18-14(11-5-8-19-10-11)16-12-4-7-17(9-12)13-3-1-2-6-15-13/h1-3,5-6,8,10,12H,4,7,9H2,(H,16,18)/t12-/m1/s1 |
| InChIKey | RXESGNVQVWWKNP-GFCCVEGCSA-N |
| XLogP | 1.68 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |