C19H20N4O2 — CID 91914548
N-[1-(5-phenyl-1H-pyrazol-3-yl)piperidin-3-yl]furan-3-carboxamide (PubChem CID 91914548) has the molecular formula C19H20N4O2 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-[1-(5-phenyl-1H-pyrazol-3-yl)piperidin-3-yl]furan-3-carboxamide.
| Compound Name | N-[1-(5-phenyl-1H-pyrazol-3-yl)piperidin-3-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 91914548 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-[1-(5-phenyl-1H-pyrazol-3-yl)piperidin-3-yl]furan-3-carboxamide |
| SMILES | O=C(NC1CCCN(c2cc(-c3ccccc3)[nH]n2)C1)c1ccoc1 |
| InChI | InChI=1S/C19H20N4O2/c24-19(15-8-10-25-13-15)20-16-7-4-9-23(12-16)18-11-17(21-22-18)14-5-2-1-3-6-14/h1-3,5-6,8,10-11,13,16H,4,7,9,12H2,(H,20,24)(H,21,22) |
| InChIKey | BPDQWWKRDGJTOB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |