C23H23N5O — CID 91887791
N-[1-(5-phenyl-1H-pyrazol-3-yl)piperidin-3-yl]-1H-indole-5-carboxamide (PubChem CID 91887791) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is N-[1-(5-phenyl-1H-pyrazol-3-yl)piperidin-3-yl]-1H-indole-5-carboxamide.
| Compound Name | N-[1-(5-phenyl-1H-pyrazol-3-yl)piperidin-3-yl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 91887791 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[1-(5-phenyl-1H-pyrazol-3-yl)piperidin-3-yl]-1H-indole-5-carboxamide |
| SMILES | O=C(NC1CCCN(c2cc(-c3ccccc3)[nH]n2)C1)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C23H23N5O/c29-23(18-8-9-20-17(13-18)10-11-24-20)25-19-7-4-12-28(15-19)22-14-21(26-27-22)16-5-2-1-3-6-16/h1-3,5-6,8-11,13-14,19,24H,4,7,12,15H2,(H,25,29)(H,26,27) |
| InChIKey | SAHWDHWXDFTJEA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 76.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |