C8H9NO2 — CID 60698418
N-cyclopropylfuran-3-carboxamide (PubChem CID 60698418) has the molecular formula C8H9NO2 and a molecular weight of 151.17 g/mol. Its IUPAC name is N-cyclopropylfuran-3-carboxamide.
| Compound Name | N-cyclopropylfuran-3-carboxamide |
|---|---|
| PubChem CID | 60698418 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | N-cyclopropylfuran-3-carboxamide |
| SMILES | O=C(NC1CC1)c1ccoc1 |
| InChI | InChI=1S/C8H9NO2/c10-8(9-7-1-2-7)6-3-4-11-5-6/h3-5,7H,1-2H2,(H,9,10) |
| InChIKey | KHMBHFCHUPUICX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |