C13H19N3O3 — CID 94200129
N-[1-[(2R)-1-amino-1-oxopropan-2-yl]piperidin-4-yl]furan-3-carboxamide (PubChem CID 94200129) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-[1-[(2R)-1-amino-1-oxopropan-2-yl]piperidin-4-yl]furan-3-carboxamide.
| Compound Name | N-[1-[(2R)-1-amino-1-oxopropan-2-yl]piperidin-4-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 94200129 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N-[1-[(2R)-1-amino-1-oxopropan-2-yl]piperidin-4-yl]furan-3-carboxamide |
| SMILES | C[C@H](C(N)=O)N1CCC(NC(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C13H19N3O3/c1-9(12(14)17)16-5-2-11(3-6-16)15-13(18)10-4-7-19-8-10/h4,7-9,11H,2-3,5-6H2,1H3,(H2,14,17)(H,15,18)/t9-/m1/s1 |
| InChIKey | YOHMUUYLFQFQJW-SECBINFHSA-N |
| XLogP | 0.35 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |