C21H30BrIN6 — CID 111922206
1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide (PubChem CID 111922206) has the molecular formula C21H30BrIN6 and a molecular weight of 573.32 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111922206 |
| Molecular Formula | C21H30BrIN6 |
| Molecular Weight | 573.32 g/mol |
| Exact Mass | 572.08 |
| IUPAC Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCNc1ccccn1)NC1CCN(c2ccccc2Br)C1.I |
| InChI | InChI=1S/C21H29BrN6.HI/c1-23-21(26-14-7-6-13-25-20-10-4-5-12-24-20)27-17-11-15-28(16-17)19-9-3-2-8-18(19)22;/h2-5,8-10,12,17H,6-7,11,13-16H2,1H3,(H,24,25)(H2,23,26,27);1H |
| InChIKey | LHQXGYCGQCBGAU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 64.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|