C16H23BrIN7 — CID 119150781
1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 119150781) has the molecular formula C16H23BrIN7 and a molecular weight of 520.22 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119150781 |
| Molecular Formula | C16H23BrIN7 |
| Molecular Weight | 520.22 g/mol |
| Exact Mass | 519.02 |
| IUPAC Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCn1cncn1)NC1CCN(c2ccccc2Br)C1.I |
| InChI | InChI=1S/C16H22BrN7.HI/c1-18-16(20-7-9-24-12-19-11-21-24)22-13-6-8-23(10-13)15-5-3-2-4-14(15)17;/h2-5,11-13H,6-10H2,1H3,(H2,18,20,22);1H |
| InChIKey | BFMWQAQTNQEWDR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|