C18H22BrN5 — CID 111922527
1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine (PubChem CID 111922527) has the molecular formula C18H22BrN5 and a molecular weight of 388.31 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111922527 |
| Molecular Formula | C18H22BrN5 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1ccccn1)NC1CCN(c2ccccc2Br)C1 |
| InChI | InChI=1S/C18H22BrN5/c1-20-18(22-12-14-6-4-5-10-21-14)23-15-9-11-24(13-15)17-8-3-2-7-16(17)19/h2-8,10,15H,9,11-13H2,1H3,(H2,20,22,23) |
| InChIKey | AABDOJGWGSNFPT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|