C18H22F2IN5 — CID 111920866
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111920866) has the molecular formula C18H22F2IN5 and a molecular weight of 473.31 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111920866 |
| Molecular Formula | C18H22F2IN5 |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccccn1)NC1CCN(c2ccc(F)cc2F)C1.I |
| InChI | InChI=1S/C18H21F2N5.HI/c1-21-18(23-11-14-4-2-3-8-22-14)24-15-7-9-25(12-15)17-6-5-13(19)10-16(17)20;/h2-6,8,10,15H,7,9,11-12H2,1H3,(H2,21,23,24);1H |
| InChIKey | DGBYEAPVZXAGJW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|