C22H29F2IN4O3 — CID 111921012
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111921012) has the molecular formula C22H29F2IN4O3 and a molecular weight of 562.40 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111921012 |
| Molecular Formula | C22H29F2IN4O3 |
| Molecular Weight | 562.40 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(OC)c(OC)c1OC)NC1CCN(c2ccc(F)cc2F)C1.I |
| InChI | InChI=1S/C22H28F2N4O3.HI/c1-25-22(26-12-14-5-8-19(29-2)21(31-4)20(14)30-3)27-16-9-10-28(13-16)18-7-6-15(23)11-17(18)24;/h5-8,11,16H,9-10,12-13H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | XFVBDVPIJYYMSO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|