C18H30F2IN5 — CID 111920718
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-[methyl(propan-2-yl)amino]ethyl]guanidine;hydroiodide (PubChem CID 111920718) has the molecular formula C18H30F2IN5 and a molecular weight of 481.37 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-[methyl(propan-2-yl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-[methyl(propan-2-yl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111920718 |
| Molecular Formula | C18H30F2IN5 |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-[methyl(propan-2-yl)amino]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCN(C)C(C)C)NC1CCN(c2ccc(F)cc2F)C1.I |
| InChI | InChI=1S/C18H29F2N5.HI/c1-13(2)24(4)10-8-22-18(21-3)23-15-7-9-25(12-15)17-6-5-14(19)11-16(17)20;/h5-6,11,13,15H,7-10,12H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | BNZFALBPVRETNV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|