C18H25F2IN6 — CID 111921094
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111921094) has the molecular formula C18H25F2IN6 and a molecular weight of 490.34 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111921094 |
| Molecular Formula | C18H25F2IN6 |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cnn(C)c1)NC1CCN(c2ccc(F)cc2F)C1.I |
| InChI | InChI=1S/C18H24F2N6.HI/c1-21-18(22-7-5-13-10-23-25(2)11-13)24-15-6-8-26(12-15)17-4-3-14(19)9-16(17)20;/h3-4,9-11,15H,5-8,12H2,1-2H3,(H2,21,22,24);1H |
| InChIKey | FUMMCLRGVVDRNK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|