C20H32F2IN5O — CID 111920882
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-(4-morpholin-4-ylbutyl)guanidine;hydroiodide (PubChem CID 111920882) has the molecular formula C20H32F2IN5O and a molecular weight of 523.41 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-(4-morpholin-4-ylbutyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-(4-morpholin-4-ylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111920882 |
| Molecular Formula | C20H32F2IN5O |
| Molecular Weight | 523.41 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-(4-morpholin-4-ylbutyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCN1CCOCC1)NC1CCN(c2ccc(F)cc2F)C1.I |
| InChI | InChI=1S/C20H31F2N5O.HI/c1-23-20(24-7-2-3-8-26-10-12-28-13-11-26)25-17-6-9-27(15-17)19-5-4-16(21)14-18(19)22;/h4-5,14,17H,2-3,6-13,15H2,1H3,(H2,23,24,25);1H |
| InChIKey | JXSPZLRFXUJISN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|