C21H34F2N6 — CID 111921223
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine (PubChem CID 111921223) has the molecular formula C21H34F2N6 and a molecular weight of 408.54 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111921223 |
| Molecular Formula | C21H34F2N6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCN1CCCN(C)CC1)NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C21H34F2N6/c1-24-21(25-8-3-10-28-11-4-9-27(2)13-14-28)26-18-7-12-29(16-18)20-6-5-17(22)15-19(20)23/h5-6,15,18H,3-4,7-14,16H2,1-2H3,(H2,24,25,26) |
| InChIKey | ZUODZJKYFTWFIN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|