C19H30F2N4O — CID 111920595
1-(3-butoxypropyl)-3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methylguanidine (PubChem CID 111920595) has the molecular formula C19H30F2N4O and a molecular weight of 368.47 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methylguanidine.
| Compound Name | 1-(3-butoxypropyl)-3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 111920595 |
| Molecular Formula | C19H30F2N4O |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 1-(3-butoxypropyl)-3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methylguanidine |
| SMILES | CCCCOCCCN/C(=N\C)NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C19H30F2N4O/c1-3-4-11-26-12-5-9-23-19(22-2)24-16-8-10-25(14-16)18-7-6-15(20)13-17(18)21/h6-7,13,16H,3-5,8-12,14H2,1-2H3,(H2,22,23,24) |
| InChIKey | XXVOZWAELDAWOI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|