C19H32F2IN5 — CID 111920282
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-[2-[ethyl(propan-2-yl)amino]ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111920282) has the molecular formula C19H32F2IN5 and a molecular weight of 495.40 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-[2-[ethyl(propan-2-yl)amino]ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-[2-[ethyl(propan-2-yl)amino]ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111920282 |
| Molecular Formula | C19H32F2IN5 |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-[2-[ethyl(propan-2-yl)amino]ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN(CCN/C(=N\C)NC1CCN(c2ccc(F)cc2F)C1)C(C)C.I |
| InChI | InChI=1S/C19H31F2N5.HI/c1-5-25(14(2)3)11-9-23-19(22-4)24-16-8-10-26(13-16)18-7-6-15(20)12-17(18)21;/h6-7,12,14,16H,5,8-11,13H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | MYZAKVZNOBZLDG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|