C17H25F2IN4O — CID 111920868
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111920868) has the molecular formula C17H25F2IN4O and a molecular weight of 466.31 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111920868 |
| Molecular Formula | C17H25F2IN4O |
| Molecular Weight | 466.31 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCCO1)NC1CCN(c2ccc(F)cc2F)C1.I |
| InChI | InChI=1S/C17H24F2N4O.HI/c1-20-17(21-10-14-3-2-8-24-14)22-13-6-7-23(11-13)16-5-4-12(18)9-15(16)19;/h4-5,9,13-14H,2-3,6-8,10-11H2,1H3,(H2,20,21,22);1H |
| InChIKey | SPICGGYSFBQJER-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|