C20H30F2IN5O — CID 111920872
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide (PubChem CID 111920872) has the molecular formula C20H30F2IN5O and a molecular weight of 521.39 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111920872 |
| Molecular Formula | C20H30F2IN5O |
| Molecular Weight | 521.39 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CN2CCCC2CO1)NC1CCN(c2ccc(F)cc2F)C1.I |
| InChI | InChI=1S/C20H29F2N5O.HI/c1-23-20(24-10-17-12-26-7-2-3-16(26)13-28-17)25-15-6-8-27(11-15)19-5-4-14(21)9-18(19)22;/h4-5,9,15-17H,2-3,6-8,10-13H2,1H3,(H2,23,24,25);1H |
| InChIKey | LJPDLIOSNAVJFS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|