C18H27FN4O — CID 111395509
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine (PubChem CID 111395509) has the molecular formula C18H27FN4O and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111395509 |
| Molecular Formula | C18H27FN4O |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1cccc(F)c1)NCC1CN2CCCC2CO1 |
| InChI | InChI=1S/C18H27FN4O/c1-20-18(21-8-7-14-4-2-5-15(19)10-14)22-11-17-12-23-9-3-6-16(23)13-24-17/h2,4-5,10,16-17H,3,6-9,11-13H2,1H3,(H2,20,21,22) |
| InChIKey | OKSLGNLEIYNUKR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|