C19H30FIN4O2 — CID 111680959
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[2-(3-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111680959) has the molecular formula C19H30FIN4O2 and a molecular weight of 492.38 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[2-(3-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[2-(3-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111680959 |
| Molecular Formula | C19H30FIN4O2 |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[2-(3-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C)Oc1cccc(F)c1)NCC1CN2CCCC2CO1.I |
| InChI | InChI=1S/C19H29FN4O2.HI/c1-14(26-17-7-3-5-15(20)9-17)10-22-19(21-2)23-11-18-12-24-8-4-6-16(24)13-25-18;/h3,5,7,9,14,16,18H,4,6,8,10-13H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | YRFBJQFUFRCRLJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|