C18H25F4IN4O — CID 111890208
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111890208) has the molecular formula C18H25F4IN4O and a molecular weight of 516.32 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111890208 |
| Molecular Formula | C18H25F4IN4O |
| Molecular Weight | 516.32 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(F)cc1C(F)(F)F)NCC1CN2CCCC2CO1.I |
| InChI | InChI=1S/C18H24F4N4O.HI/c1-23-17(25-9-15-10-26-6-2-3-14(26)11-27-15)24-8-12-4-5-13(19)7-16(12)18(20,21)22;/h4-5,7,14-15H,2-3,6,8-11H2,1H3,(H2,23,24,25);1H |
| InChIKey | YTPMHYDIMNQTBK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|