C18H26F2N4O2 — CID 111866454
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[[2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine (PubChem CID 111866454) has the molecular formula C18H26F2N4O2 and a molecular weight of 368.43 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[[2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[[2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111866454 |
| Molecular Formula | C18H26F2N4O2 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[[2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccccc1OC(F)F)NCC1CN2CCCC2CO1 |
| InChI | InChI=1S/C18H26F2N4O2/c1-21-18(22-9-13-5-2-3-7-16(13)26-17(19)20)23-10-15-11-24-8-4-6-14(24)12-25-15/h2-3,5,7,14-15,17H,4,6,8-12H2,1H3,(H2,21,22,23) |
| InChIKey | BZGKDGDBEYXXNZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|