C16H25F2IN4O2S — CID 111920690
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-(3-methylsulfonylpropyl)guanidine;hydroiodide (PubChem CID 111920690) has the molecular formula C16H25F2IN4O2S and a molecular weight of 502.37 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-(3-methylsulfonylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-(3-methylsulfonylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111920690 |
| Molecular Formula | C16H25F2IN4O2S |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-(3-methylsulfonylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCS(C)(=O)=O)NC1CCN(c2ccc(F)cc2F)C1.I |
| InChI | InChI=1S/C16H24F2N4O2S.HI/c1-19-16(20-7-3-9-25(2,23)24)21-13-6-8-22(11-13)15-5-4-12(17)10-14(15)18;/h4-5,10,13H,3,6-9,11H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | TWFSXQHJFMUGHP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|