C17H26BrIN4O — CID 111922528
1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111922528) has the molecular formula C17H26BrIN4O and a molecular weight of 509.23 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111922528 |
| Molecular Formula | C17H26BrIN4O |
| Molecular Weight | 509.23 g/mol |
| Exact Mass | 508.03 |
| IUPAC Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCCO1)NC1CCN(c2ccccc2Br)C1.I |
| InChI | InChI=1S/C17H25BrN4O.HI/c1-19-17(20-11-14-5-4-10-23-14)21-13-8-9-22(12-13)16-7-3-2-6-15(16)18;/h2-3,6-7,13-14H,4-5,8-12H2,1H3,(H2,19,20,21);1H |
| InChIKey | AKGNAGNLAAMWIJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|