C17H25BrN4O2S — CID 111922697
1-[1-(2-bromophenyl)pyrrolidin-3-yl]-3-[(1,1-dioxothiolan-3-yl)methyl]-2-methylguanidine (PubChem CID 111922697) has the molecular formula C17H25BrN4O2S and a molecular weight of 429.38 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-3-[(1,1-dioxothiolan-3-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-3-[(1,1-dioxothiolan-3-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111922697 |
| Molecular Formula | C17H25BrN4O2S |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-3-[(1,1-dioxothiolan-3-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCC1CCS(=O)(=O)C1)NC1CCN(c2ccccc2Br)C1 |
| InChI | InChI=1S/C17H25BrN4O2S/c1-19-17(20-10-13-7-9-25(23,24)12-13)21-14-6-8-22(11-14)16-5-3-2-4-15(16)18/h2-5,13-14H,6-12H2,1H3,(H2,19,20,21) |
| InChIKey | GCHPRGYANMYCAK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|