C19H30F2IN5 — CID 111920270
1-[2-[cyclopropyl(methyl)amino]propyl]-3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide (PubChem CID 111920270) has the molecular formula C19H30F2IN5 and a molecular weight of 493.38 g/mol. Its IUPAC name is 1-[2-[cyclopropyl(methyl)amino]propyl]-3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-[cyclopropyl(methyl)amino]propyl]-3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111920270 |
| Molecular Formula | C19H30F2IN5 |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 1-[2-[cyclopropyl(methyl)amino]propyl]-3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C)N(C)C1CC1)NC1CCN(c2ccc(F)cc2F)C1.I |
| InChI | InChI=1S/C19H29F2N5.HI/c1-13(25(3)16-5-6-16)11-23-19(22-2)24-15-8-9-26(12-15)18-7-4-14(20)10-17(18)21;/h4,7,10,13,15-16H,5-6,8-9,11-12H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | KIOHKSULJASZQP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|