C24H31F2N5O — CID 111920607
N-butan-2-yl-4-[[[N-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]benzamide (PubChem CID 111920607) has the molecular formula C24H31F2N5O and a molecular weight of 443.54 g/mol. Its IUPAC name is N-butan-2-yl-4-[[[N-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-butan-2-yl-4-[[[N-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111920607 |
| Molecular Formula | C24H31F2N5O |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | N-butan-2-yl-4-[[[N-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]benzamide |
| SMILES | CCC(C)NC(=O)c1ccc(CN/C(=N\C)NC2CCN(c3ccc(F)cc3F)C2)cc1 |
| InChI | InChI=1S/C24H31F2N5O/c1-4-16(2)29-23(32)18-7-5-17(6-8-18)14-28-24(27-3)30-20-11-12-31(15-20)22-10-9-19(25)13-21(22)26/h5-10,13,16,20H,4,11-12,14-15H2,1-3H3,(H,29,32)(H2,27,28,30) |
| InChIKey | NITRZBNPOOJWES-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|