C23H29F2N5O2 — CID 111921531
4-[[[N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]-N-ethylbenzamide (PubChem CID 111921531) has the molecular formula C23H29F2N5O2 and a molecular weight of 445.51 g/mol. Its IUPAC name is 4-[[[N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]-N-ethylbenzamide.
| Compound Name | 4-[[[N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 111921531 |
| Molecular Formula | C23H29F2N5O2 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 4-[[[N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(CN/C(=N\C)NC2CCN(c3ccccc3OC(F)F)C2)cc1 |
| InChI | InChI=1S/C23H29F2N5O2/c1-3-27-21(31)17-10-8-16(9-11-17)14-28-23(26-2)29-18-12-13-30(15-18)19-6-4-5-7-20(19)32-22(24)25/h4-11,18,22H,3,12-15H2,1-2H3,(H,27,31)(H2,26,28,29) |
| InChIKey | APKAQNZCZPVRPM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|