C19H29F2N5O2 — CID 111921921
N-[2-[[N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide (PubChem CID 111921921) has the molecular formula C19H29F2N5O2 and a molecular weight of 397.47 g/mol. Its IUPAC name is N-[2-[[N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[[N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 111921921 |
| Molecular Formula | C19H29F2N5O2 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | N-[2-[[N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide |
| SMILES | C/N=C(\NCCNC(=O)C(C)C)NC1CCN(c2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C19H29F2N5O2/c1-13(2)17(27)23-9-10-24-19(22-3)25-14-8-11-26(12-14)15-6-4-5-7-16(15)28-18(20)21/h4-7,13-14,18H,8-12H2,1-3H3,(H,23,27)(H2,22,24,25) |
| InChIKey | OXOXQLPVRUZJGJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|