C19H28F5N5O — CID 111921927
1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine (PubChem CID 111921927) has the molecular formula C19H28F5N5O and a molecular weight of 437.46 g/mol. Its IUPAC name is 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine.
| Compound Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 111921927 |
| Molecular Formula | C19H28F5N5O |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)NC1CCN(c2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C19H28F5N5O/c1-25-18(26-9-5-10-28(2)13-19(22,23)24)27-14-8-11-29(12-14)15-6-3-4-7-16(15)30-17(20)21/h3-4,6-7,14,17H,5,8-13H2,1-2H3,(H2,25,26,27) |
| InChIKey | UCUOYKQENMFYOJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|