C22H36F2N6O — CID 111922129
1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine (PubChem CID 111922129) has the molecular formula C22H36F2N6O and a molecular weight of 438.57 g/mol. Its IUPAC name is 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine.
| Compound Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111922129 |
| Molecular Formula | C22H36F2N6O |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCN1CCCN(C)CC1)NC1CCN(c2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C22H36F2N6O/c1-25-22(26-10-5-12-29-13-6-11-28(2)15-16-29)27-18-9-14-30(17-18)19-7-3-4-8-20(19)31-21(23)24/h3-4,7-8,18,21H,5-6,9-17H2,1-2H3,(H2,25,26,27) |
| InChIKey | NXRWMBFZQIMSAU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|