C21H33F2N5O — CID 111921463
1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methyl-3-(2-methyl-3-pyrrolidin-1-ylpropyl)guanidine (PubChem CID 111921463) has the molecular formula C21H33F2N5O and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methyl-3-(2-methyl-3-pyrrolidin-1-ylpropyl)guanidine.
| Compound Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methyl-3-(2-methyl-3-pyrrolidin-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111921463 |
| Molecular Formula | C21H33F2N5O |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methyl-3-(2-methyl-3-pyrrolidin-1-ylpropyl)guanidine |
| SMILES | C/N=C(\NCC(C)CN1CCCC1)NC1CCN(c2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C21H33F2N5O/c1-16(14-27-10-5-6-11-27)13-25-21(24-2)26-17-9-12-28(15-17)18-7-3-4-8-19(18)29-20(22)23/h3-4,7-8,16-17,20H,5-6,9-15H2,1-2H3,(H2,24,25,26) |
| InChIKey | ZEJQQWZMMCUXSI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|