C24H32F2IN5O — CID 111920484
N-[3-[[[N-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylbutanamide;hydroiodide (PubChem CID 111920484) has the molecular formula C24H32F2IN5O and a molecular weight of 571.45 g/mol. Its IUPAC name is N-[3-[[[N-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylbutanamide;hydroiodide.
| Compound Name | N-[3-[[[N-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylbutanamide;hydroiodide |
|---|---|
| PubChem CID | 111920484 |
| Molecular Formula | C24H32F2IN5O |
| Molecular Weight | 571.45 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | N-[3-[[[N-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylbutanamide;hydroiodide |
| SMILES | CCC(C)C(=O)Nc1cccc(CN/C(=N\C)NC2CCN(c3ccc(F)cc3F)C2)c1.I |
| InChI | InChI=1S/C24H31F2N5O.HI/c1-4-16(2)23(32)29-19-7-5-6-17(12-19)14-28-24(27-3)30-20-10-11-31(15-20)22-9-8-18(25)13-21(22)26;/h5-9,12-13,16,20H,4,10-11,14-15H2,1-3H3,(H,29,32)(H2,27,28,30);1H |
| InChIKey | XHGSUQGTYSLCCE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|