C22H25F2IN6 — CID 111921194
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111921194) has the molecular formula C22H25F2IN6 and a molecular weight of 538.38 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111921194 |
| Molecular Formula | C22H25F2IN6 |
| Molecular Weight | 538.38 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ncc(-c2ccccc2)[nH]1)NC1CCN(c2ccc(F)cc2F)C1.I |
| InChI | InChI=1S/C22H24F2N6.HI/c1-25-22(27-13-21-26-12-19(29-21)15-5-3-2-4-6-15)28-17-9-10-30(14-17)20-8-7-16(23)11-18(20)24;/h2-8,11-12,17H,9-10,13-14H2,1H3,(H,26,29)(H2,25,27,28);1H |
| InChIKey | ILQJUAJPBNDFPD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|