C21H24F2N6 — CID 111920965
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(1-methylbenzimidazol-2-yl)methyl]guanidine (PubChem CID 111920965) has the molecular formula C21H24F2N6 and a molecular weight of 398.46 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(1-methylbenzimidazol-2-yl)methyl]guanidine.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(1-methylbenzimidazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111920965 |
| Molecular Formula | C21H24F2N6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(1-methylbenzimidazol-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1nc2ccccc2n1C)NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C21H24F2N6/c1-24-21(25-12-20-27-17-5-3-4-6-19(17)28(20)2)26-15-9-10-29(13-15)18-8-7-14(22)11-16(18)23/h3-8,11,15H,9-10,12-13H2,1-2H3,(H2,24,25,26) |
| InChIKey | AMLWTXAZDLZACH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|