C19H26N6 — CID 119150295
1-(1-cyclopropylpyrrolidin-3-yl)-2-methyl-3-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine (PubChem CID 119150295) has the molecular formula C19H26N6 and a molecular weight of 338.46 g/mol. Its IUPAC name is 1-(1-cyclopropylpyrrolidin-3-yl)-2-methyl-3-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine.
| Compound Name | 1-(1-cyclopropylpyrrolidin-3-yl)-2-methyl-3-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119150295 |
| Molecular Formula | C19H26N6 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 1-(1-cyclopropylpyrrolidin-3-yl)-2-methyl-3-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ncc(-c2ccccc2)[nH]1)NC1CCN(C2CC2)C1 |
| InChI | InChI=1S/C19H26N6/c1-20-19(23-15-9-10-25(13-15)16-7-8-16)22-12-18-21-11-17(24-18)14-5-3-2-4-6-14/h2-6,11,15-16H,7-10,12-13H2,1H3,(H,21,24)(H2,20,22,23) |
| InChIKey | YJVZUDJIKDZLAS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|