C21H29N5O — CID 119150732
1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[(3-phenyl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 119150732) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[(3-phenyl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[(3-phenyl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119150732 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[(3-phenyl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1cc(-c2ccccc2)no1)NC1CCN(C2CCCC2)C1 |
| InChI | InChI=1S/C21H29N5O/c1-22-21(24-17-11-12-26(15-17)18-9-5-6-10-18)23-14-19-13-20(25-27-19)16-7-3-2-4-8-16/h2-4,7-8,13,17-18H,5-6,9-12,14-15H2,1H3,(H2,22,23,24) |
| InChIKey | JYMLJGPXZNMHOB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|