C18H24N4O — CID 119130050
N',3-dimethyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]piperidine-1-carboximidamide (PubChem CID 119130050) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N',3-dimethyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]piperidine-1-carboximidamide.
| Compound Name | N',3-dimethyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 119130050 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N',3-dimethyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cc(-c2ccccc2)no1)N1CCCC(C)C1 |
| InChI | InChI=1S/C18H24N4O/c1-14-7-6-10-22(13-14)18(19-2)20-12-16-11-17(21-23-16)15-8-4-3-5-9-15/h3-5,8-9,11,14H,6-7,10,12-13H2,1-2H3,(H,19,20) |
| InChIKey | BAJCAPKEWYJJQD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|