C18H29N5O2 — CID 111918531
2-[[N-(1-cyclopentylpyrrolidin-3-yl)-N'-methylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 111918531) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[[N-(1-cyclopentylpyrrolidin-3-yl)-N'-methylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[[N-(1-cyclopentylpyrrolidin-3-yl)-N'-methylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 111918531 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | 2-[[N-(1-cyclopentylpyrrolidin-3-yl)-N'-methylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | C/N=C(\NCC(=O)NCc1ccco1)NC1CCN(C2CCCC2)C1 |
| InChI | InChI=1S/C18H29N5O2/c1-19-18(21-12-17(24)20-11-16-7-4-10-25-16)22-14-8-9-23(13-14)15-5-2-3-6-15/h4,7,10,14-15H,2-3,5-6,8-9,11-13H2,1H3,(H,20,24)(H2,19,21,22) |
| InChIKey | RMBGUKKOQVZSFP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|