C21H31IN6 — CID 111918546
1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111918546) has the molecular formula C21H31IN6 and a molecular weight of 494.43 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111918546 |
| Molecular Formula | C21H31IN6 |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(-n2cccn2)cc1)NC1CCN(C2CCCC2)C1.I |
| InChI | InChI=1S/C21H30N6.HI/c1-22-21(25-18-11-14-26(16-18)19-5-2-3-6-19)23-15-17-7-9-20(10-8-17)27-13-4-12-24-27;/h4,7-10,12-13,18-19H,2-3,5-6,11,14-16H2,1H3,(H2,22,23,25);1H |
| InChIKey | FJMJVIUEDQJYPB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|