C24H32IN5O2 — CID 111912893
2-methyl-N-[3-[[[N'-methyl-N-(5-oxo-1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide (PubChem CID 111912893) has the molecular formula C24H32IN5O2 and a molecular weight of 549.46 g/mol. Its IUPAC name is 2-methyl-N-[3-[[[N'-methyl-N-(5-oxo-1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide.
| Compound Name | 2-methyl-N-[3-[[[N'-methyl-N-(5-oxo-1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide |
|---|---|
| PubChem CID | 111912893 |
| Molecular Formula | C24H32IN5O2 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | 2-methyl-N-[3-[[[N'-methyl-N-(5-oxo-1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide |
| SMILES | CCC(C)C(=O)Nc1cccc(CN/C(=N\C)NC2CC(=O)N(c3ccccc3)C2)c1.I |
| InChI | InChI=1S/C24H31N5O2.HI/c1-4-17(2)23(31)27-19-10-8-9-18(13-19)15-26-24(25-3)28-20-14-22(30)29(16-20)21-11-6-5-7-12-21;/h5-13,17,20H,4,14-16H2,1-3H3,(H,27,31)(H2,25,26,28);1H |
| InChIKey | SXXDGHUXSLRCSV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|