C24H34IN5O — CID 111909062
2-methyl-N-[3-[[[N'-methyl-N-(1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide (PubChem CID 111909062) has the molecular formula C24H34IN5O and a molecular weight of 535.47 g/mol. Its IUPAC name is 2-methyl-N-[3-[[[N'-methyl-N-(1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide.
| Compound Name | 2-methyl-N-[3-[[[N'-methyl-N-(1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide |
|---|---|
| PubChem CID | 111909062 |
| Molecular Formula | C24H34IN5O |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 2-methyl-N-[3-[[[N'-methyl-N-(1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide |
| SMILES | CCC(C)C(=O)Nc1cccc(CN/C(=N\C)NC2CCN(c3ccccc3)C2)c1.I |
| InChI | InChI=1S/C24H33N5O.HI/c1-4-18(2)23(30)27-20-10-8-9-19(15-20)16-26-24(25-3)28-21-13-14-29(17-21)22-11-6-5-7-12-22;/h5-12,15,18,21H,4,13-14,16-17H2,1-3H3,(H,27,30)(H2,25,26,28);1H |
| InChIKey | OXYYENDPPJQNEX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|