C24H35IN6O — CID 111923536
2-(dimethylamino)-N-[3-[[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide (PubChem CID 111923536) has the molecular formula C24H35IN6O and a molecular weight of 550.49 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-[[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide.
| Compound Name | 2-(dimethylamino)-N-[3-[[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111923536 |
| Molecular Formula | C24H35IN6O |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 2-(dimethylamino)-N-[3-[[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(NC(=O)CN(C)C)c1)NC1CCN(c2ccc(C)cc2)C1.I |
| InChI | InChI=1S/C24H34N6O.HI/c1-18-8-10-22(11-9-18)30-13-12-21(16-30)28-24(25-2)26-15-19-6-5-7-20(14-19)27-23(31)17-29(3)4;/h5-11,14,21H,12-13,15-17H2,1-4H3,(H,27,31)(H2,25,26,28);1H |
| InChIKey | VLKDDYVZGBLUQD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|