C24H34N6O — CID 111909883
2-(dimethylamino)-N-[3-[[[ethylamino-[(1-phenylpyrrolidin-3-yl)amino]methylidene]amino]methyl]phenyl]acetamide (PubChem CID 111909883) has the molecular formula C24H34N6O and a molecular weight of 422.58 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-[[[ethylamino-[(1-phenylpyrrolidin-3-yl)amino]methylidene]amino]methyl]phenyl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[3-[[[ethylamino-[(1-phenylpyrrolidin-3-yl)amino]methylidene]amino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 111909883 |
| Molecular Formula | C24H34N6O |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 2-(dimethylamino)-N-[3-[[[ethylamino-[(1-phenylpyrrolidin-3-yl)amino]methylidene]amino]methyl]phenyl]acetamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)CN(C)C)c1)NC1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C24H34N6O/c1-4-25-24(28-21-13-14-30(17-21)22-11-6-5-7-12-22)26-16-19-9-8-10-20(15-19)27-23(31)18-29(2)3/h5-12,15,21H,4,13-14,16-18H2,1-3H3,(H,27,31)(H2,25,26,28) |
| InChIKey | WKYGFUUPQMBNRN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|