C25H35IN6O — CID 111910340
N-[3-[[[ethylamino-[(1-phenylpyrrolidin-3-yl)amino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide (PubChem CID 111910340) has the molecular formula C25H35IN6O and a molecular weight of 562.50 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[(1-phenylpyrrolidin-3-yl)amino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-[(1-phenylpyrrolidin-3-yl)amino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111910340 |
| Molecular Formula | C25H35IN6O |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | N-[3-[[[ethylamino-[(1-phenylpyrrolidin-3-yl)amino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)N2CCCC2)c1)NC1CCN(c2ccccc2)C1.I |
| InChI | InChI=1S/C25H34N6O.HI/c1-2-26-24(28-22-13-16-31(19-22)23-11-4-3-5-12-23)27-18-20-9-8-10-21(17-20)29-25(32)30-14-6-7-15-30;/h3-5,8-12,17,22H,2,6-7,13-16,18-19H2,1H3,(H,29,32)(H2,26,27,28);1H |
| InChIKey | VLARRYOWCKNPGD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|