C21H32F3IN6O — CID 111914131
N-[3-[[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide (PubChem CID 111914131) has the molecular formula C21H32F3IN6O and a molecular weight of 568.43 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111914131 |
| Molecular Formula | C21H32F3IN6O |
| Molecular Weight | 568.43 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | N-[3-[[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)N2CCCC2)c1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C21H31F3N6O.HI/c1-2-25-19(27-18-8-11-29(14-18)15-21(22,23)24)26-13-16-6-5-7-17(12-16)28-20(31)30-9-3-4-10-30;/h5-7,12,18H,2-4,8-11,13-15H2,1H3,(H,28,31)(H2,25,26,27);1H |
| InChIKey | HWFNRXDGROUFKM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|