C19H29F3IN5O — CID 111915114
2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-N-(3-ethylphenyl)acetamide;hydroiodide (PubChem CID 111915114) has the molecular formula C19H29F3IN5O and a molecular weight of 527.37 g/mol. Its IUPAC name is 2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-N-(3-ethylphenyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-N-(3-ethylphenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111915114 |
| Molecular Formula | C19H29F3IN5O |
| Molecular Weight | 527.37 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | 2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-N-(3-ethylphenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1cccc(CC)c1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C19H28F3N5O.HI/c1-3-14-6-5-7-15(10-14)25-17(28)11-24-18(23-4-2)26-16-8-9-27(12-16)13-19(20,21)22;/h5-7,10,16H,3-4,8-9,11-13H2,1-2H3,(H,25,28)(H2,23,24,26);1H |
| InChIKey | KBJPIGZKECKNSU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|