C18H27F3IN5O2 — CID 111994192
N-[2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]ethyl]-2-hydroxybenzamide;hydroiodide (PubChem CID 111994192) has the molecular formula C18H27F3IN5O2 and a molecular weight of 529.35 g/mol. Its IUPAC name is N-[2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]ethyl]-2-hydroxybenzamide;hydroiodide.
| Compound Name | N-[2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]ethyl]-2-hydroxybenzamide;hydroiodide |
|---|---|
| PubChem CID | 111994192 |
| Molecular Formula | C18H27F3IN5O2 |
| Molecular Weight | 529.35 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | N-[2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]ethyl]-2-hydroxybenzamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccccc1O)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C18H26F3N5O2.HI/c1-2-22-17(25-13-7-10-26(11-13)12-18(19,20)21)24-9-8-23-16(28)14-5-3-4-6-15(14)27;/h3-6,13,27H,2,7-12H2,1H3,(H,23,28)(H2,22,24,25);1H |
| InChIKey | MTIYKFZLOWBYSN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|