C18H26ClF3IN5O — CID 111914499
2-chloro-N-[2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]ethyl]benzamide;hydroiodide (PubChem CID 111914499) has the molecular formula C18H26ClF3IN5O and a molecular weight of 547.79 g/mol. Its IUPAC name is 2-chloro-N-[2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 2-chloro-N-[2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111914499 |
| Molecular Formula | C18H26ClF3IN5O |
| Molecular Weight | 547.79 g/mol |
| Exact Mass | 547.08 |
| IUPAC Name | 2-chloro-N-[2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]ethyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccccc1Cl)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C18H25ClF3N5O.HI/c1-2-23-17(26-13-7-10-27(11-13)12-18(20,21)22)25-9-8-24-16(28)14-5-3-4-6-15(14)19;/h3-6,13H,2,7-12H2,1H3,(H,24,28)(H2,23,25,26);1H |
| InChIKey | MGEPFFFGTXLFLL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.79 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|